cas: 1235374-46-5 — see every product listed under this CAS number, including other names
7-BROMO-4-CHLOROIMIDAZO[2,1-F][1,2,4]TRIAZINE, 97% (CAS 1235374-46-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467989-100MG |
| cas | 1235374-46-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 810.15 Pln | |
| Fluorochem | 250mg | 1539.06 Pln | |
| Fluorochem | 500mg | 2517.88 Pln | |
| Fluorochem | 1g | 4142.31 Pln | |
| Fluorochem | 5g | 19293.22 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7-bromo-4-chloroimidazo[2,1-f][1,2,4]triazine (CAS 1235374-46-5) is a chemical compound with the molecular formula C5H2BrClN4 and a molecular weight of 233.45 g/mol. IUPAC name: 7-bromo-4-chloroimidazo[2,1-f][1,2,4]triazine. InChIKey: RRXLWAFFBIFFKO-UHFFFAOYSA-N.
| Molecular formula | C5H2BrClN4 |
|---|---|
| Molecular weight | 233.45 g/mol |
| IUPAC name | 7-bromo-4-chloroimidazo[2,1-f][1,2,4]triazine |
| InChIKey | RRXLWAFFBIFFKO-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=N1)C(=NC=N2)Cl)Br |
Computed by PubChem (NCBI)