cas: 1235374-46-5 — see every product listed under this CAS number, including other names
7-Bromo-4-chloroimidazo(2,1-f)(1,2,4)triazine, 97% (CAS 1235374-46-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 50mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A959187-5g |
| cas | 1235374-46-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 23200.03 Pln | |
| AmBeed | 1g | 7777.84 Pln | |
| AmBeed | 50mg | 1593.34 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-bromo-4-chloroimidazo[2,1-f][1,2,4]triazine (CAS 1235374-46-5) is a chemical compound with the molecular formula C5H2BrClN4 and a molecular weight of 233.45 g/mol. IUPAC name: 7-bromo-4-chloroimidazo[2,1-f][1,2,4]triazine. InChIKey: RRXLWAFFBIFFKO-UHFFFAOYSA-N.
| Molecular formula | C5H2BrClN4 |
|---|---|
| Molecular weight | 233.45 g/mol |
| IUPAC name | 7-bromo-4-chloroimidazo[2,1-f][1,2,4]triazine |
| InChIKey | RRXLWAFFBIFFKO-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=N1)C(=NC=N2)Cl)Br |
Computed by PubChem (NCBI)