cas: 869640-41-5 — see every product listed under this CAS number, including other names
7-Benzyl-5,6,7,8-Tetrahydro-1,7-Naphthyridin-2(1H)-One, 95%, 95% (CAS 869640-41-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115L53-50mg |
| cas | 869640-41-5 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 405.20 Pln | |
| Chemat | 100mg | 640.40 Pln | |
| Chemat | 250mg | 1125.20 Pln | |
| Chemat | 1g | 2718.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-benzyl-1,5,6,8-tetrahydro-1,7-naphthyridin-2-one (CAS 869640-41-5) is a chemical compound with the molecular formula C15H16N2O and a molecular weight of 240.30 g/mol. IUPAC name: 7-benzyl-1,5,6,8-tetrahydro-1,7-naphthyridin-2-one. InChIKey: IAXZYZLBSPZMGH-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 7-benzyl-1,5,6,8-tetrahydro-1,7-naphthyridin-2-one |
| InChIKey | IAXZYZLBSPZMGH-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1C=CC(=O)N2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)