cas: 37509-14-1 — see every product listed under this CAS number, including other names
7-Bromo-1,2,3,4-tetrahydroacridine-9-carboxylic acid, ≥95%, ≥95% (CAS 37509-14-1) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C1LT-1g |
| cas | 37509-14-1 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 990.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
7-bromo-1,2,3,4-tetrahydroacridine-9-carboxylic acid (CAS 37509-14-1) is a chemical compound with the molecular formula C14H12BrNO2 and a molecular weight of 306.15 g/mol. IUPAC name: 7-bromo-1,2,3,4-tetrahydroacridine-9-carboxylic acid. InChIKey: INXRKMNRRUIKBF-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO2 |
|---|---|
| Molecular weight | 306.15 g/mol |
| IUPAC name | 7-bromo-1,2,3,4-tetrahydroacridine-9-carboxylic acid |
| InChIKey | INXRKMNRRUIKBF-UHFFFAOYSA-N |
| SMILES | C1CCC2=NC3=C(C=C(C=C3)Br)C(=C2C1)C(=O)O |
Computed by PubChem (NCBI)