CAS 1820665-08-4 is the registry number for 4-(Benzyloxy)-2-bromobenzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-bromo-4-phenylmethoxybenzamide (CAS 1820665-08-4) is a chemical compound with the molecular formula C14H12BrNO2 and a molecular weight of 306.15 g/mol. IUPAC name: 2-bromo-4-phenylmethoxybenzamide. InChIKey: RYJKKIIFSNBNLC-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO2 |
|---|---|
| Molecular weight | 306.15 g/mol |
| IUPAC name | 2-bromo-4-phenylmethoxybenzamide |
| InChIKey | RYJKKIIFSNBNLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)C(=O)N)Br |
Computed by PubChem (NCBI)