CAS 92159-87-0 appears in our catalog under these names: Benzyl N-(4-bromophenyl)carbamate, 98%, Benzyl (4-bromophenyl)carbamate, 98%, 98%, BENZYL 4-BROMOPHENYLCARBAMATE, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg.
Benzyl N-(4-bromophenyl)carbamate (CAS 92159-87-0) is a chemical compound with the molecular formula C14H12BrNO2 and a molecular weight of 306.15 g/mol. IUPAC name: benzyl N-(4-bromophenyl)carbamate. InChIKey: OGIRMVQVHNCXEH-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO2 |
|---|---|
| Molecular weight | 306.15 g/mol |
| IUPAC name | benzyl N-(4-bromophenyl)carbamate |
| InChIKey | OGIRMVQVHNCXEH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)