CAS 1072944-33-2 is the registry number for N-Phenyl 4-bromo-3-methoxybenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
4-bromo-3-methoxy-N-phenylbenzamide (CAS 1072944-33-2) is a chemical compound with the molecular formula C14H12BrNO2 and a molecular weight of 306.15 g/mol. IUPAC name: 4-bromo-3-methoxy-N-phenylbenzamide. InChIKey: AIWJLYCHRYWNNL-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO2 |
|---|---|
| Molecular weight | 306.15 g/mol |
| IUPAC name | 4-bromo-3-methoxy-N-phenylbenzamide |
| InChIKey | AIWJLYCHRYWNNL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)NC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)