cas: 1189106-80-6 — see every product listed under this CAS number, including other names
7-Bromo-2,8-dimethylquinolin-4-ol, 98% (CAS 1189106-80-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A321802-250mg |
| cas | 1189106-80-6 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 467.11 Pln | |
| AmBeed | 100mg | 395.50 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-bromo-2,8-dimethyl-1H-quinolin-4-one (CAS 1189106-80-6) is a chemical compound with the molecular formula C11H10BrNO and a molecular weight of 252.11 g/mol. IUPAC name: 7-bromo-2,8-dimethyl-1H-quinolin-4-one. InChIKey: ZBMQLNRKZDXRPA-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 7-bromo-2,8-dimethyl-1H-quinolin-4-one |
| InChIKey | ZBMQLNRKZDXRPA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(N1)C(=C(C=C2)Br)C |
Computed by PubChem (NCBI)