cas: 1189106-80-6 — see every product listed under this CAS number, including other names
7-bromo-2,8-dimethyl-1,4-dihydroquinolin-4-one, 96% (CAS 1189106-80-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F763909-100MG |
| cas | 1189106-80-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 164.54 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 981.96 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
7-bromo-2,8-dimethyl-1H-quinolin-4-one (CAS 1189106-80-6) is a chemical compound with the molecular formula C11H10BrNO and a molecular weight of 252.11 g/mol. IUPAC name: 7-bromo-2,8-dimethyl-1H-quinolin-4-one. InChIKey: ZBMQLNRKZDXRPA-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 7-bromo-2,8-dimethyl-1H-quinolin-4-one |
| InChIKey | ZBMQLNRKZDXRPA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(N1)C(=C(C=C2)Br)C |
Computed by PubChem (NCBI)