CAS 723280-94-2 appears in our catalog under these names: 4-Quinolinol, 7-bromo-3-nitro-, 97%, 97%, 7-BROMO-3-NITRO-4-QUINOLINOL, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
7-bromo-3-nitro-1H-quinolin-4-one (CAS 723280-94-2) is a chemical compound with the molecular formula C9H5BrN2O3 and a molecular weight of 269.05 g/mol. IUPAC name: 7-bromo-3-nitro-1H-quinolin-4-one. InChIKey: QJMLADCOCGDUQT-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O3 |
|---|---|
| Molecular weight | 269.05 g/mol |
| IUPAC name | 7-bromo-3-nitro-1H-quinolin-4-one |
| InChIKey | QJMLADCOCGDUQT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC=C(C2=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)