Products 885523-37-5
CAS 885523-37-5 appears in our catalog under these names: 4-Bromo-3-formyl-1h-indazole-6-carboxylic acid, 95%, 4-Bromo-3-formyl-1H-indazole-6-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
4-bromo-3-formyl-2H-indazole-6-carboxylic acid (CAS 885523-37-5) is a chemical compound with the molecular formula C9H5BrN2O3 and a molecular weight of 269.05 g/mol. IUPAC name: 4-bromo-3-formyl-2H-indazole-6-carboxylic acid. InChIKey: IVFLTQPQOXRHQM-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O3 |
|---|---|
| Molecular weight | 269.05 g/mol |
| IUPAC name | 4-bromo-3-formyl-2H-indazole-6-carboxylic acid |
| InChIKey | IVFLTQPQOXRHQM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C(NN=C21)C=O)Br)C(=O)O |
Computed by PubChem (NCBI)