CAS 1638604-66-6 is the registry number for 5-(2-Bromo-5-nitrophenyl)oxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-(2-bromo-5-nitrophenyl)-1,3-oxazole (CAS 1638604-66-6) is a chemical compound with the molecular formula C9H5BrN2O3 and a molecular weight of 269.05 g/mol. IUPAC name: 5-(2-bromo-5-nitrophenyl)-1,3-oxazole. InChIKey: QHULERCLNVVLCN-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O3 |
|---|---|
| Molecular weight | 269.05 g/mol |
| IUPAC name | 5-(2-bromo-5-nitrophenyl)-1,3-oxazole |
| InChIKey | QHULERCLNVVLCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C2=CN=CO2)Br |
Computed by PubChem (NCBI)