Products 944896-66-6
CAS 944896-66-6 is the registry number for 3-(3-Bromophenyl)-1,2,4-oxadiazole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-bromophenyl)-1,2,4-oxadiazole-5-carboxylic acid (CAS 944896-66-6) is a chemical compound with the molecular formula C9H5BrN2O3 and a molecular weight of 269.05 g/mol. IUPAC name: 3-(3-bromophenyl)-1,2,4-oxadiazole-5-carboxylic acid. InChIKey: CMMBFHOGFRNXKL-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O3 |
|---|---|
| Molecular weight | 269.05 g/mol |
| IUPAC name | 3-(3-bromophenyl)-1,2,4-oxadiazole-5-carboxylic acid |
| InChIKey | CMMBFHOGFRNXKL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NOC(=N2)C(=O)O |
Computed by PubChem (NCBI)