cas: 1273596-20-5 — see every product listed under this CAS number, including other names
7-Bromo-3-oxo-2,3-dihydro-1H-indene-5-carboxylic acid 95% (CAS 1273596-20-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A471855-100mg |
| cas | 1273596-20-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 909.94 Pln | |
| Ambeed | 1g | 3107.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A471855 |
7-bromo-3-oxo-1,2-dihydroindene-5-carboxylic acid (CAS 1273596-20-5) is a chemical compound with the molecular formula C10H7BrO3 and a molecular weight of 255.06 g/mol. IUPAC name: 7-bromo-3-oxo-1,2-dihydroindene-5-carboxylic acid. InChIKey: HYDNZQPQWFHSEP-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO3 |
|---|---|
| Molecular weight | 255.06 g/mol |
| IUPAC name | 7-bromo-3-oxo-1,2-dihydroindene-5-carboxylic acid |
| InChIKey | HYDNZQPQWFHSEP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=CC(=C2)C(=O)O)Br |
Computed by PubChem (NCBI)