7-Bromo-4-chloro-2,3-dihydro-1H-inden-1-one, 97%
cas: 149965-64-0 — see every product listed under this CAS number, including other names
7-Bromo-4-chloro-2,3-dihydro-1H-inden-1-one, 97% (CAS 149965-64-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A116481-250mg |
| cas | 149965-64-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1605.25 Pln | |
| Ambeed | 10g | 2372.88 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 1101.20 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 408.77 Pln | |
| BLDpharm | 5g | 1724.97 Pln | |
| BLDpharm | 10g | 2552.46 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
7-bromo-4-chloro-2,3-dihydroinden-1-one (CAS 149965-64-0) is a chemical compound with the molecular formula C9H6BrClO and a molecular weight of 245.50 g/mol. IUPAC name: 7-bromo-4-chloro-2,3-dihydroinden-1-one. InChIKey: CUAVICMAMOYPOY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClO |
|---|---|
| Molecular weight | 245.50 g/mol |
| IUPAC name | 7-bromo-4-chloro-2,3-dihydroinden-1-one |
| InChIKey | CUAVICMAMOYPOY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)Cl)Br |
Computed by PubChem (NCBI)