Products 1337850-20-0
CAS 1337850-20-0 appears in our catalog under these names: 6-Bromo-7-chloro-1-indanone, 95%, 6–Bromo–7–chloro–2，3–dihydro–1H–inden–1–one, 6-Bromo-7-chloro-2,3-dihydro-1H-inden-1-one, 97%, 97%, 6-Bromo-7-chloro-2,3-dihydro-1H-inden-1-one, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
6-bromo-7-chloro-2,3-dihydroinden-1-one (CAS 1337850-20-0) is a chemical compound with the molecular formula C9H6BrClO and a molecular weight of 245.50 g/mol. IUPAC name: 6-bromo-7-chloro-2,3-dihydroinden-1-one. InChIKey: JCLQTPFCUKJMMS-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClO |
|---|---|
| Molecular weight | 245.50 g/mol |
| IUPAC name | 6-bromo-7-chloro-2,3-dihydroinden-1-one |
| InChIKey | JCLQTPFCUKJMMS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=CC(=C2Cl)Br |
Computed by PubChem (NCBI)