Products 13565-09-8
CAS 13565-09-8 appears in our catalog under these names: (2E)-3-(4-Bromophenyl)acryloyl chloride, 96%, (E)-3-(4-Bromophenyl)acryloyl chloride 95%, (2E)-3-(4-BROMOPHENYL)ACRYLOYL CHLORIDE, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 10g, 25g, 1g, 100mg.
(E)-3-(4-bromophenyl)prop-2-enoyl chloride (CAS 13565-09-8) is a chemical compound with the molecular formula C9H6BrClO and a molecular weight of 245.50 g/mol. IUPAC name: (E)-3-(4-bromophenyl)prop-2-enoyl chloride. InChIKey: YLABICHHIYWLQM-ZZXKWVIFSA-N.
| Molecular formula | C9H6BrClO |
|---|---|
| Molecular weight | 245.50 g/mol |
| IUPAC name | (E)-3-(4-bromophenyl)prop-2-enoyl chloride |
| InChIKey | YLABICHHIYWLQM-ZZXKWVIFSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)Cl)Br |
Computed by PubChem (NCBI)
Synonyms:
(E)-3-(4-bromophenyl)prop-2-enoyl Chloride, (2E)-3-(4-bromophenyl)prop-2-enoyl chloride, (E)-3-(4-Bromophenyl)acryloyl Chloride, 2-Propenoyl chloride, 3-(4-bromophenyl)-, (2E)-, (2E)-3-(4-Bromophenyl)-2-propenoyl chloride, namoylchlorid, namicacidchloride, trans-4-Brom-cin-, (E)-4-bromocin-, 4-bromocinnamoylchloride