CAS 149965-64-0 appears in our catalog under these names: 7-Bromo-4-chloro-1-indanone, 95%, 7–Bromo–4–chloro–2,3–dihydro–1H–inden–1–one, 7-Bromo-4-chloro-2,3-dihydro-1H-inden-1-one, 7-Bromo-4-chloro-2,3-dihydro-1H-inden-1-one 97%, 7-Bromo-4-chloro-2,3-dihydro-1H-inden-1-one, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 2,5g, 10g, 500mg.
7-bromo-4-chloro-2,3-dihydroinden-1-one (CAS 149965-64-0) is a chemical compound with the molecular formula C9H6BrClO and a molecular weight of 245.50 g/mol. IUPAC name: 7-bromo-4-chloro-2,3-dihydroinden-1-one. InChIKey: CUAVICMAMOYPOY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClO |
|---|---|
| Molecular weight | 245.50 g/mol |
| IUPAC name | 7-bromo-4-chloro-2,3-dihydroinden-1-one |
| InChIKey | CUAVICMAMOYPOY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)Cl)Br |
Computed by PubChem (NCBI)