cas: 1235374-46-5 — see every product listed under this CAS number, including other names
7-Bromo-4-chloroimidazo[2,1-f][1,2,4]triazine, 97%, 97% (CAS 1235374-46-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111KQH-100mg |
| cas | 1235374-46-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 467.60 Pln | |
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 500mg | 1413.20 Pln | |
| Chemat | 1g | 2315.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-bromo-4-chloroimidazo[2,1-f][1,2,4]triazine (CAS 1235374-46-5) is a chemical compound with the molecular formula C5H2BrClN4 and a molecular weight of 233.45 g/mol. IUPAC name: 7-bromo-4-chloroimidazo[2,1-f][1,2,4]triazine. InChIKey: RRXLWAFFBIFFKO-UHFFFAOYSA-N.
| Molecular formula | C5H2BrClN4 |
|---|---|
| Molecular weight | 233.45 g/mol |
| IUPAC name | 7-bromo-4-chloroimidazo[2,1-f][1,2,4]triazine |
| InChIKey | RRXLWAFFBIFFKO-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=N1)C(=NC=N2)Cl)Br |
Computed by PubChem (NCBI)