CAS 1479026-17-9 is the registry number for 5-Bromo-7-fluoro-1-benzofuran-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-bromo-7-fluoro-1-benzofuran-3-carboxylic acid (CAS 1479026-17-9) is a chemical compound with the molecular formula C9H4BrFO3 and a molecular weight of 259.03 g/mol. IUPAC name: 5-bromo-7-fluoro-1-benzofuran-3-carboxylic acid. InChIKey: TTWPBIZYCBMVIA-UHFFFAOYSA-N.
| Molecular formula | C9H4BrFO3 |
|---|---|
| Molecular weight | 259.03 g/mol |
| IUPAC name | 5-bromo-7-fluoro-1-benzofuran-3-carboxylic acid |
| InChIKey | TTWPBIZYCBMVIA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=CO2)C(=O)O)F)Br |
Computed by PubChem (NCBI)