Products 2520349-31-7

CAS 2520349-31-7 is the registry number for 6-Bromo-4-fluorobenzofuran-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-bromo-4-fluoro-1-benzofuran-2-carboxylic acid (CAS 2520349-31-7) is a chemical compound with the molecular formula C9H4BrFO3 and a molecular weight of 259.03 g/mol. IUPAC name: 6-bromo-4-fluoro-1-benzofuran-2-carboxylic acid. InChIKey: JPDNENDPJFTVPM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4BrFO3
Molecular weight259.03 g/mol
IUPAC name6-bromo-4-fluoro-1-benzofuran-2-carboxylic acid
InChIKeyJPDNENDPJFTVPM-UHFFFAOYSA-N
SMILESC1=C(C=C(C2=C1OC(=C2)C(=O)O)F)Br

Computed by PubChem (NCBI)