CAS 2306277-31-4 appears in our catalog under these names: 7-Bromo-6-fluoro-benzofuran-5-carboxylic acid, 95%, 7-Bromo-6-fluoro-benzofuran-5-carboxylic acid, 97%, 7-Bromo-6-fluoro-benzofuran-5-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg.
7-bromo-6-fluoro-1-benzofuran-5-carboxylic acid (CAS 2306277-31-4) is a chemical compound with the molecular formula C9H4BrFO3 and a molecular weight of 259.03 g/mol. IUPAC name: 7-bromo-6-fluoro-1-benzofuran-5-carboxylic acid. InChIKey: IDBAGRYHUWPTEW-UHFFFAOYSA-N.
| Molecular formula | C9H4BrFO3 |
|---|---|
| Molecular weight | 259.03 g/mol |
| IUPAC name | 7-bromo-6-fluoro-1-benzofuran-5-carboxylic acid |
| InChIKey | IDBAGRYHUWPTEW-UHFFFAOYSA-N |
| SMILES | C1=COC2=C(C(=C(C=C21)C(=O)O)F)Br |
Computed by PubChem (NCBI)