cas: 1019021-93-2 — see every product listed under this CAS number, including other names
7-Bromoimidazo[1,2-a]pyridine-3-carboxylic acid, 98% (CAS 1019021-93-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F432619-100MG |
| cas | 1019021-93-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 758.08 Pln | |
| Fluorochem | 5g | 2262.76 Pln | |
| Fluorochem | 10g | 4006.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
7-bromoimidazo[1,2-a]pyridine-3-carboxylic acid (CAS 1019021-93-2) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 7-bromoimidazo[1,2-a]pyridine-3-carboxylic acid. InChIKey: NNBDKJHKUYMGLT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 7-bromoimidazo[1,2-a]pyridine-3-carboxylic acid |
| InChIKey | NNBDKJHKUYMGLT-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC=C2C(=O)O)C=C1Br |
Computed by PubChem (NCBI)