cas: 114703-12-7 — see every product listed under this CAS number, including other names
7-Bromoquinazoline-2,4(1H,3H)-dione, 98%, 98% (CAS 114703-12-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111F43-100mg |
| cas | 114703-12-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 10g | 318.80 Pln | |
| Chemat | 25g | 650.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-bromo-1H-quinazoline-2,4-dione (CAS 114703-12-7) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 7-bromo-1H-quinazoline-2,4-dione. InChIKey: AQIDPSGSKHPDAY-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 7-bromo-1H-quinazoline-2,4-dione |
| InChIKey | AQIDPSGSKHPDAY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC(=O)NC2=O |
Computed by PubChem (NCBI)