7-Chloro-1-benzofuran-2-carboxylic acid, 98%
cas: 63558-84-9 — see every product listed under this CAS number, including other names
7-Chloro-1-benzofuran-2-carboxylic acid, 98% (CAS 63558-84-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F649015-100MG |
| cas | 63558-84-9 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 487.35 Pln | |
| Fluorochem | 1g | 940.31 Pln | |
| Fluorochem | 5g | 2611.60 Pln | |
| Fluorochem | 10g | 3850.75 Pln | |
| Fluorochem | 25g | 9536.24 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
7-chloro-1-benzofuran-2-carboxylic acid (CAS 63558-84-9) is a chemical compound with the molecular formula C9H5ClO3 and a molecular weight of 196.58 g/mol. IUPAC name: 7-chloro-1-benzofuran-2-carboxylic acid. InChIKey: RWLLNFLRPKWFIF-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO3 |
|---|---|
| Molecular weight | 196.58 g/mol |
| IUPAC name | 7-chloro-1-benzofuran-2-carboxylic acid |
| InChIKey | RWLLNFLRPKWFIF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)OC(=C2)C(=O)O |
Computed by PubChem (NCBI)