cas: 86393-33-1 — see every product listed under this CAS number, including other names
7-Chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid, 98%, 98% (CAS 86393-33-1) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145E7-25mg |
| cas | 86393-33-1 |
| size | 25mg |
| availability | 9000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 69.20 Pln | |
| Chemat | 50mg | 74.00 Pln | |
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 50g | 107.60 Pln | |
| Chemat | 100g | 122.00 Pln | |
| Chemat | 500g | 403.20 Pln | |
| Chemat | 1kg | 726.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid (CAS 86393-33-1) is a chemical compound with the molecular formula C13H9ClFNO3 and a molecular weight of 281.66 g/mol. IUPAC name: 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid. InChIKey: ISPVACVJFUIDPD-UHFFFAOYSA-N.
| Molecular formula | C13H9ClFNO3 |
|---|---|
| Molecular weight | 281.66 g/mol |
| IUPAC name | 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| InChIKey | ISPVACVJFUIDPD-UHFFFAOYSA-N |
| SMILES | C1CC1N2C=C(C(=O)C3=CC(=C(C=C32)Cl)F)C(=O)O |
Computed by PubChem (NCBI)