CAS 1111084-78-6 appears in our catalog under these names: FERb 033, FERb 033. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 500mg, 10mg, 50mg, 25mg, 100mg, Get quote.
2-chloro-3-(3-fluoro-4-hydroxyphenyl)-6-[(E)-hydroxyiminomethyl]phenol (CAS 1111084-78-6) is a chemical compound with the molecular formula C13H9ClFNO3 and a molecular weight of 281.66 g/mol. IUPAC name: 2-chloro-3-(3-fluoro-4-hydroxyphenyl)-6-[(E)-hydroxyiminomethyl]phenol. InChIKey: LRRMQNGSYOUANY-OMCISZLKSA-N.
| Molecular formula | C13H9ClFNO3 |
|---|---|
| Molecular weight | 281.66 g/mol |
| IUPAC name | 2-chloro-3-(3-fluoro-4-hydroxyphenyl)-6-[(E)-hydroxyiminomethyl]phenol |
| InChIKey | LRRMQNGSYOUANY-OMCISZLKSA-N |
| SMILES | C1=CC(=C(C=C1C2=C(C(=C(C=C2)/C=N/O)O)Cl)F)O |
Computed by PubChem (NCBI)