CAS 339008-79-6 appears in our catalog under these names: 1-(2-Chloro-6-fluorobenzyl)-2-oxo-1,2-dihydro-3-pyridinecarboxylic acid, 95%, 1-((2-Chloro-6-fluorophenyl)methyl)-2-oxo-1,2-dihydropyridine-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[(2-chloro-6-fluorophenyl)methyl]-2-oxopyridine-3-carboxylic acid (CAS 339008-79-6) is a chemical compound with the molecular formula C13H9ClFNO3 and a molecular weight of 281.66 g/mol. IUPAC name: 1-[(2-chloro-6-fluorophenyl)methyl]-2-oxopyridine-3-carboxylic acid. InChIKey: LCAXQPJGSCIVJV-UHFFFAOYSA-N.
| Molecular formula | C13H9ClFNO3 |
|---|---|
| Molecular weight | 281.66 g/mol |
| IUPAC name | 1-[(2-chloro-6-fluorophenyl)methyl]-2-oxopyridine-3-carboxylic acid |
| InChIKey | LCAXQPJGSCIVJV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CN2C=CC=C(C2=O)C(=O)O)F |
Computed by PubChem (NCBI)