Products 160312-26-5

CAS 160312-26-5 is the registry number for Enrofloxacin Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-chloro-1-cyclopropyl-7-fluoro-4-oxoquinoline-3-carboxylic acid (CAS 160312-26-5) is a chemical compound with the molecular formula C13H9ClFNO3 and a molecular weight of 281.66 g/mol. IUPAC name: 6-chloro-1-cyclopropyl-7-fluoro-4-oxoquinoline-3-carboxylic acid. InChIKey: FAIPGRCVZDBAJG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9ClFNO3
Molecular weight281.66 g/mol
IUPAC name6-chloro-1-cyclopropyl-7-fluoro-4-oxoquinoline-3-carboxylic acid
InChIKeyFAIPGRCVZDBAJG-UHFFFAOYSA-N
SMILESC1CC1N2C=C(C(=O)C3=CC(=C(C=C32)F)Cl)C(=O)O

Computed by PubChem (NCBI)