cas: 4965-33-7 — see every product listed under this CAS number, including other names
7-Chloro-2-methylquinoline 97% (CAS 4965-33-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A288315-5g |
| cas | 4965-33-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 170.12 Pln | |
| Ambeed | 100g | 275.81 Pln | |
| Ambeed | 500g | 854.31 Pln | |
| Ambeed | 1000g | 1377.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A288315 |
7-chloro-2-methylquinoline (CAS 4965-33-7) is a chemical compound with the molecular formula C10H8ClN and a molecular weight of 177.63 g/mol. IUPAC name: 7-chloro-2-methylquinoline. InChIKey: WQZQFYRSYLXBGP-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | 7-chloro-2-methylquinoline |
| InChIKey | WQZQFYRSYLXBGP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)