cas: 4965-33-7 — see every product listed under this CAS number, including other names
7-Chloroquinaldine, >98.0%(GC) (CAS 4965-33-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C1453-5G |
| cas | 4965-33-7 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 187.19 Pln | |
| TCI | 25g | 639.57 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
7-chloro-2-methylquinoline (CAS 4965-33-7) is a chemical compound with the molecular formula C10H8ClN and a molecular weight of 177.63 g/mol. IUPAC name: 7-chloro-2-methylquinoline. InChIKey: WQZQFYRSYLXBGP-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | 7-chloro-2-methylquinoline |
| InChIKey | WQZQFYRSYLXBGP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)