cas: 885461-50-7 — see every product listed under this CAS number, including other names
7-Chloro-5-methyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine, 95% (CAS 885461-50-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F464148-100MG |
| cas | 885461-50-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 690.40 Pln | |
| Fluorochem | 1g | 1747.32 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
7-chloro-5-methyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine (CAS 885461-50-7) is a chemical compound with the molecular formula C7H4ClF3N4 and a molecular weight of 236.58 g/mol. IUPAC name: 7-chloro-5-methyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine. InChIKey: ZPRYBESGXFDOSK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3N4 |
|---|---|
| Molecular weight | 236.58 g/mol |
| IUPAC name | 7-chloro-5-methyl-2-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| InChIKey | ZPRYBESGXFDOSK-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC(=NN2C(=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)