CAS 916259-16-0 is the registry number for 6-Chloro-7-methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-7-methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine (CAS 916259-16-0) is a chemical compound with the molecular formula C7H4ClF3N4 and a molecular weight of 236.58 g/mol. IUPAC name: 6-chloro-7-methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: MDRDMPAIQKKFFN-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3N4 |
|---|---|
| Molecular weight | 236.58 g/mol |
| IUPAC name | 6-chloro-7-methyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | MDRDMPAIQKKFFN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NN=C(N2N=C1Cl)C(F)(F)F |
Computed by PubChem (NCBI)