CAS 1206640-61-0 is the registry number for 8-Chloro-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (CAS 1206640-61-0) is a chemical compound with the molecular formula C7H4ClF3N4 and a molecular weight of 236.58 g/mol. IUPAC name: 8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine. InChIKey: LLAPLJGOFXCNFY-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3N4 |
|---|---|
| Molecular weight | 236.58 g/mol |
| IUPAC name | 8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| InChIKey | LLAPLJGOFXCNFY-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC(=NN2C=C1C(F)(F)F)N)Cl |
Computed by PubChem (NCBI)