CAS 1644-75-3 appears in our catalog under these names: 2-Chloro-9-methyl-6-(trifluoromethyl)-9H-purine, 97%, 2-Chloro-9-methyl-6-(trifluoromethyl)-9H-purine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-chloro-9-methyl-6-(trifluoromethyl)purine (CAS 1644-75-3) is a chemical compound with the molecular formula C7H4ClF3N4 and a molecular weight of 236.58 g/mol. IUPAC name: 2-chloro-9-methyl-6-(trifluoromethyl)purine. InChIKey: AVWDQAFPAQLSFQ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3N4 |
|---|---|
| Molecular weight | 236.58 g/mol |
| IUPAC name | 2-chloro-9-methyl-6-(trifluoromethyl)purine |
| InChIKey | AVWDQAFPAQLSFQ-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C(N=C(N=C21)Cl)C(F)(F)F |
Computed by PubChem (NCBI)