cas: 734524-15-3 — see every product listed under this CAS number, including other names
7-FLUOROQUINOLINE-3-CARBOXYLIC ACID, 97%, 97% (CAS 734524-15-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116ZI3-100mg |
| cas | 734524-15-3 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1302.80 Pln | |
| Chemat | 10g | 2128.40 Pln | |
| Chemat | 25g | 4197.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-fluoroquinoline-3-carboxylic acid (CAS 734524-15-3) is a chemical compound with the molecular formula C10H6FNO2 and a molecular weight of 191.16 g/mol. IUPAC name: 7-fluoroquinoline-3-carboxylic acid. InChIKey: PXJCGANFXZBADU-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO2 |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 7-fluoroquinoline-3-carboxylic acid |
| InChIKey | PXJCGANFXZBADU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC=C(C=C21)C(=O)O)F |
Computed by PubChem (NCBI)