cas: 380638-36-8 — see every product listed under this CAS number, including other names
7-Fluoro-2,3-dihydropyrrolo[2,1-b]quinazolin-9(1H)-one, 98% (CAS 380638-36-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F689919-100MG |
| cas | 380638-36-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 138.51 Pln | |
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 669.57 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
7-fluoro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-one (CAS 380638-36-8) is a chemical compound with the molecular formula C11H9FN2O and a molecular weight of 204.20 g/mol. IUPAC name: 7-fluoro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-one. InChIKey: FCWCQPPXEADXGL-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 7-fluoro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-one |
| InChIKey | FCWCQPPXEADXGL-UHFFFAOYSA-N |
| SMILES | C1CC2=NC3=C(C=C(C=C3)F)C(=O)N2C1 |
Computed by PubChem (NCBI)