cas: 54212-34-9 — see every product listed under this CAS number, including other names
7-Methoxyisochroman-4-one 98% (CAS 54212-34-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A172596-10g |
| cas | 54212-34-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 3974.88 Pln | |
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 2511.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A172596 |
7-methoxy-1H-isochromen-4-one (CAS 54212-34-9) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 7-methoxy-1H-isochromen-4-one. InChIKey: BPLNVFZLTMUAEI-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 7-methoxy-1H-isochromen-4-one |
| InChIKey | BPLNVFZLTMUAEI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)COC2 |
Computed by PubChem (NCBI)