7-Nitro-1H-indole, 99%, 99%
cas: 6960-42-5 — see every product listed under this CAS number, including other names
7-Nitro-1H-indole, 99%, 99% (CAS 6960-42-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 500g, 1kg, 5kg, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NGR-1g |
| cas | 6960-42-5 |
| size | 1g |
| availability | 10000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 25g | 270.80 Pln | |
| Chemat | 500g | 4089.60 Pln | |
| Chemat | 1kg | 5195.60 Pln | |
| Chemat | 5kg | 25569.60 Pln | |
| Chemat | 50g | 482.00 Pln | |
| Chemat | 100g | 894.80 Pln | |
| Chemat | 250g | 2094.80 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
7-nitro-1H-indole (CAS 6960-42-5) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 7-nitro-1H-indole. InChIKey: LZJGQIVWUKFTRD-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 7-nitro-1H-indole |
| InChIKey | LZJGQIVWUKFTRD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])NC=C2 |
Computed by PubChem (NCBI)