Products 6960-42-5
CAS 6960-42-5 appears in our catalog under these names: 7–Nitroindole, 7-Nitroindole, >98.0%(GC), 7-Nitroindole, 7-Nitroindole 98%, 7-Nitro-1H-indole, 99%, 99%. Offered by: GLPBio, TCI, Biosynth, Ambeed, Chemat. Available pack sizes: 100g, 25g, 1g, 5g, 0,1kg, 0,25kg, 0,5kg, 1kg.
7-nitro-1H-indole (CAS 6960-42-5) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 7-nitro-1H-indole. InChIKey: LZJGQIVWUKFTRD-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 7-nitro-1H-indole |
| InChIKey | LZJGQIVWUKFTRD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])NC=C2 |
Computed by PubChem (NCBI)