cas: 89793-81-7 — see every product listed under this CAS number, including other names
7-Nitrobenzo[d]thiazol-2-amine 95% (CAS 89793-81-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A217645-100mg |
| cas | 89793-81-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1371.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A217645 |
7-nitro-1,3-benzothiazol-2-amine (CAS 89793-81-7) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 7-nitro-1,3-benzothiazol-2-amine. InChIKey: JMRCAIHFSHXPPH-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 7-nitro-1,3-benzothiazol-2-amine |
| InChIKey | JMRCAIHFSHXPPH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])SC(=N2)N |
Computed by PubChem (NCBI)