cas: 89793-81-7 — see every product listed under this CAS number, including other names
7-Nitrobenzo[d]thiazol-2-amine, 95%, 95% (CAS 89793-81-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114YGP-10g |
| cas | 89793-81-7 |
| size | 10g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1782.80 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 923.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-nitro-1,3-benzothiazol-2-amine (CAS 89793-81-7) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 7-nitro-1,3-benzothiazol-2-amine. InChIKey: JMRCAIHFSHXPPH-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 7-nitro-1,3-benzothiazol-2-amine |
| InChIKey | JMRCAIHFSHXPPH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])SC(=N2)N |
Computed by PubChem (NCBI)