cas: 2227206-54-2 — see every product listed under this CAS number, including other names
7-bromo-4-fluoro-1-benzofuran-5-carboxylic acid, 97% (CAS 2227206-54-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A207042-5g |
| cas | 2227206-54-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 26500.60 Pln | |
| Fluorochem | 1g | 8130.49 Pln | |
| Chemat | 100mg | 1235.60 Pln | |
| Chemat | 250mg | 2022.80 Pln | |
| Chemat | 500mg | 3323.60 Pln | |
| Fluorochem | 100mg | 2294.00 Pln | |
| Fluorochem | 250mg | 3736.20 Pln | |
| Fluorochem | 500mg | 6167.64 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-bromo-4-fluoro-1-benzofuran-5-carboxylic acid (CAS 2227206-54-2) is a chemical compound with the molecular formula C9H4BrFO3 and a molecular weight of 259.03 g/mol. IUPAC name: 7-bromo-4-fluoro-1-benzofuran-5-carboxylic acid. InChIKey: LRLWRVKUGNQOAY-UHFFFAOYSA-N.
| Molecular formula | C9H4BrFO3 |
|---|---|
| Molecular weight | 259.03 g/mol |
| IUPAC name | 7-bromo-4-fluoro-1-benzofuran-5-carboxylic acid |
| InChIKey | LRLWRVKUGNQOAY-UHFFFAOYSA-N |
| SMILES | C1=COC2=C(C=C(C(=C21)F)C(=O)O)Br |
Computed by PubChem (NCBI)