cas: 1092350-77-0 — see every product listed under this CAS number, including other names
7-bromo-8-fluorochroman-4-one, 95%, 95% (CAS 1092350-77-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BVQS-100mg |
| cas | 1092350-77-0 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 942.80 Pln | |
| Chemat | 5g | 2896.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-bromo-8-fluoro-2,3-dihydrochromen-4-one (CAS 1092350-77-0) is a chemical compound with the molecular formula C9H6BrFO2 and a molecular weight of 245.04 g/mol. IUPAC name: 7-bromo-8-fluoro-2,3-dihydrochromen-4-one. InChIKey: KPAFVSLIXPVEOJ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFO2 |
|---|---|
| Molecular weight | 245.04 g/mol |
| IUPAC name | 7-bromo-8-fluoro-2,3-dihydrochromen-4-one |
| InChIKey | KPAFVSLIXPVEOJ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=CC(=C2F)Br |
Computed by PubChem (NCBI)