Products 289038-17-1
CAS 289038-17-1 appears in our catalog under these names: 2-Bromo-4-fluorocinnamic acid, 98%, 2-Bromo-4-fluorocinnamic acid. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 25g, 5g, 100g, 10g.
(E)-3-(2-bromo-4-fluorophenyl)prop-2-enoic acid (CAS 289038-17-1) is a chemical compound with the molecular formula C9H6BrFO2 and a molecular weight of 245.04 g/mol. IUPAC name: (E)-3-(2-bromo-4-fluorophenyl)prop-2-enoic acid. InChIKey: KCEJGSKYYLDTNE-DUXPYHPUSA-N.
| Molecular formula | C9H6BrFO2 |
|---|---|
| Molecular weight | 245.04 g/mol |
| IUPAC name | (E)-3-(2-bromo-4-fluorophenyl)prop-2-enoic acid |
| InChIKey | KCEJGSKYYLDTNE-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Bromo-4-fluorocinnamic acid, 3-(2-Bromo-4-fluorophenyl)acrylic acid, (E)-3-(2-bromo-4-fluorophenyl)prop-2-enoic acid, (E)-3-(2-bromo-4-fluorophenyl)acrylic acid, 2-Propenoic acid, 3-(2-bromo-4-fluorophenyl)-, 3-(2-bromo-4-fluorophenyl)prop-2-enoic acid, starbld0007540, (E)-3-(2-bromo-4-fluoro-phenyl)prop-2-enoic acid