Products 149947-19-3
CAS 149947-19-3 appears in our catalog under these names: 4-Bromo-2-fluorocinnamic acid, 96%, 4–Bromo–2–fluorocinnamic acid, 4-Bromo-2-fluorocinnamic acid, 98%, 98%, 4-Bromo-2-fluorocinnamic acid. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 1g.
3-(4-bromo-2-fluorophenyl)prop-2-enoic acid (CAS 149947-19-3) is a chemical compound with the molecular formula C9H6BrFO2 and a molecular weight of 245.04 g/mol. IUPAC name: 3-(4-bromo-2-fluorophenyl)prop-2-enoic acid. InChIKey: SVJGKQYKYNDYMU-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFO2 |
|---|---|
| Molecular weight | 245.04 g/mol |
| IUPAC name | 3-(4-bromo-2-fluorophenyl)prop-2-enoic acid |
| InChIKey | SVJGKQYKYNDYMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C=CC(=O)O |
Computed by PubChem (NCBI)