CAS 1260008-29-4 appears in our catalog under these names: 5–Bromo–7–fluorochroman–4–one, 5-Bromo-7-fluorochroman-4-one, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
5-bromo-7-fluoro-2,3-dihydrochromen-4-one (CAS 1260008-29-4) is a chemical compound with the molecular formula C9H6BrFO2 and a molecular weight of 245.04 g/mol. IUPAC name: 5-bromo-7-fluoro-2,3-dihydrochromen-4-one. InChIKey: HAVWPXAFESISPA-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFO2 |
|---|---|
| Molecular weight | 245.04 g/mol |
| IUPAC name | 5-bromo-7-fluoro-2,3-dihydrochromen-4-one |
| InChIKey | HAVWPXAFESISPA-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C(=CC(=C2)F)Br |
Computed by PubChem (NCBI)