cas: 688790-06-9 — see every product listed under this CAS number, including other names
7-tert-Butyl 2-methyl 7-azabicyclo(2.2.1)heptane-2,7-dicarboxylate, 98+% (CAS 688790-06-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A910142-1g |
| cas | 688790-06-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 8506.96 Pln | |
| AmBeed | 100mg | 2094.61 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-O-tert-butyl 2-O-methyl 7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate (CAS 688790-06-9) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 7-O-tert-butyl 2-O-methyl 7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate. InChIKey: ZBESKVIRYNQXCD-UHFFFAOYSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 7-O-tert-butyl 2-O-methyl 7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate |
| InChIKey | ZBESKVIRYNQXCD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1C(C2)C(=O)OC |
Computed by PubChem (NCBI)