CAS 163458-37-5 is the registry number for (1R,2R,4S)-7-tert-Butyl 2-methyl 7-azabicyclo(2.2.1)heptane-2,7-dicarboxylate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
7-O-tert-butyl 2-O-methyl (1R,2R,4S)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate (CAS 163458-37-5) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 7-O-tert-butyl 2-O-methyl (1R,2R,4S)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate. InChIKey: ZBESKVIRYNQXCD-IVZWLZJFSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 7-O-tert-butyl 2-O-methyl (1R,2R,4S)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate |
| InChIKey | ZBESKVIRYNQXCD-IVZWLZJFSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2CC[C@@H]1[C@@H](C2)C(=O)OC |
Computed by PubChem (NCBI)