CAS 1246308-83-7 appears in our catalog under these names: 7H-Benzofuro[2,3-b]carbazole, 97%, 97%, 7H-benzofuro[2,3-b]carbazole, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
7H-[1]benzofuro[2,3-b]carbazole (CAS 1246308-83-7) is a chemical compound with the molecular formula C18H11NO and a molecular weight of 257.3 g/mol. IUPAC name: 7H-[1]benzofuro[2,3-b]carbazole. InChIKey: ISBQNNXMWRWLNW-UHFFFAOYSA-N.
| Molecular formula | C18H11NO |
|---|---|
| Molecular weight | 257.3 g/mol |
| IUPAC name | 7H-[1]benzofuro[2,3-b]carbazole |
| InChIKey | ISBQNNXMWRWLNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC4=C(C=C3N2)OC5=CC=CC=C54 |
Computed by PubChem (NCBI)